Arginine (data page)
From Wikipedia, the free encyclopedia
| The complete data for Arginine | ||||||||||||||||
| General information Chemical formula: C6H14N4O2
Molar mass: 174.2 g·mol-1 Systematic name: 2-amino-5-(diaminomethylidene amino)pentanoic acid Abbreviations: R, Arg Synonyms: 2-amino-5-guanidinopentanoic acid 2-amino-5-guanidinovaleric acid AIDS{-}121865 AIDS{-}159840 Argamine Arginin Argivene CHEBI:29016 CHEMBANK2983 Detoxargin Harg Levargin Minophagen A R-Gene |
||||||||||||||||
| Database data | ||||||||||||||||
| SMILES: NC(=N)NCCCC(N)C(=O)O InChI=1/C6H14N4O2/c7-4(5(11)12)2-1-3-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10)/f/h11H,8-9H2
|
||||||||||||||||
| Physical properties | ||||||||||||||||
|
||||||||||||||||
| Hazard properties | ||||||||||||||||
|
||||||||||||||||
| Chemical properties | ||||||||||||||||
|
||||||||||||||||
| Pharmacological properties | ||||||||||||||||
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | ||||||||||||||||
- a EINECS number 205-866-5 ((-)-D-arginine hydrate)
- a EINECS number 200-811-1 (for L-arginine)
- a CID 71070 from PubChem (D-arginine)
- a CID 6322 from PubChem (L-arginine)
| Major families of biochemicals | ||
| Peptides | Amino acids | Nucleic acids | Carbohydrates | Nucleotide sugars | Lipids | Terpenes | Carotenoids | Tetrapyrroles | Enzyme cofactors | Steroids | Flavonoids | Alkaloids | Polyketides | Glycosides | ||
| Analogues of nucleic acids: | The 20 Common Amino Acids ("dp" = data page) | Analogues of nucleic acids: |
| Alanine (dp) | Arginine (dp) | Asparagine (dp) | Aspartic acid (dp) | Cysteine (dp) | Glutamic acid (dp) | Glutamine (dp) | Glycine (dp) | Histidine (dp) | Isoleucine (dp) | Leucine (dp) | Lysine (dp) | Methionine (dp) | Phenylalanine (dp) | Proline (dp) | Serine (dp) | Threonine (dp) | Tryptophan (dp) | Tyrosine (dp) | Valine (dp) | ||