Zeaxanthin
From Wikipedia, the free encyclopedia
Zeaxanthin is one of the two carotenoids contained within the retina.
| Zeaxanthin | ||
|---|---|---|
| General | ||
| Systematic name | 4-[18-(4-hydroxy-2,6,6-trimethyl-1-cyclohexenyl)- 3,7,12,16-tetramethyl-octadeca- 1,3,5,7,9,11,13,15,17-nonaenyl]- 3,5,5-trimethyl-cyclohex-3-en-1-ol |
|
| Other names | zeaxanthin; ß,ß-carotene-3,3'-diol | |
| Molecular formula | C40H56O2 | |
| SMILES | CC(C=CC=C(C)C=CC1(C(C)(C)CC(O)CC(C)=1)) =CC=CC=C(C)C=CC=C(C) C=CC2(C(C)(C)CC(O)CC(C)=2) |
|
| Molar mass | 568.88 g/mol | |
| Appearance | orange-red | |
| CAS number | 144-68-3 | |
| PubChem | 91445 | |
| EINECS | 205-636-491445 | |
| Properties | ||
| Density and phase | ? g/cm3, ? | |
| Solubility in water | insol. | |
| Melting point | 215.5 °C (488.7 K) | |
| Boiling point | ? °C (? K) | |
| Acidity (pKa) | ? | |
| Basicity (pKb) | ? | |
| Chiral rotation [α]D | ?° | |
| Viscosity | ? cP at ? °C | |
| Hazards | ||
| MSDS | External MSDS | |
| Main hazards | ? | |
| NFPA 704 | ||
| Flash point | ? °C | |
| R/S statement | R: ? S: ? |
|
| RTECS number | ? | |
| Supplementary data page | ||
| Structure and properties |
n, εr, etc. | |
| Thermodynamic data |
Phase behaviour Solid, liquid, gas |
|
| Spectral data | UV, IR, NMR, MS | |
| Related compounds | ||
| Other anions | ? | |
| Other cations | ? | |
| Related ? | ? | |
| Related compounds | lutein xanthophyll |
|
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
||
Within the central macula, zeaxanthin is the dominant component, whereas in the peripheral retina, lutein predominates.
Lutein and zeaxanthin have identical chemical formulas and are isomers, but they are not stereoisomers. The main difference between them is in the location of a double bond in one of the end rings. This difference gives lutein three chiral centers whereas zeaxanthin has two.
As a food additive, zeaxanthin is a food dye with E number E161h.
Contents |
Because of symmetry, the (3R,3'S) and (3S,3'R) stereoisomers of zeaxanthin are identical. Therefore, zeaxanthin has only three stereoisomeric forms. The (3R,3'S) stereoisomer is called meso-zeaxanthin.
The principal natural form of zeaxanthin is (3R,3'R)-zeaxanthin.
The macula mainly contains the (3R,3'R)- and meso-zeaxanthin forms, but it also contains much smaller amounts of the third (3S,3'S) form.
There is epidemiological evidence of a relationship between low plasma concentrations of lutein and zeaxanthin on the one hand, and the risk of developing age-related macular degeneration (AMD) on the other. Some studies support the view that supplemental lutein and/or zeaxanthin help protect against AMD.
There is also epidemiological evidence that increasing lutein and zeaxanthin intake lowers the risk of cataract development.
Zeaxanthin is one of the most common carotenoid alcohols found in nature. It is the pigment that gives corn, saffron, and many other plants their characteristic color. Zeaxanthin breaks down to form picrocrocin and safranal, which are responsible for the taste and aroma of saffron.
| Major Families of Biochemicals | ||
| Peptides | Amino acids | Nucleic acids | Carbohydrates | Lipids | Terpenes | Carotenoids | Tetrapyrroles | Enzyme cofactors | Steroids | Flavonoids | Alkaloids | Polyketides | Glycosides | ||
| Analogues of nucleic acids: | Types of Carotenoids | Analogues of nucleic acids: |
| General: | ||
|---|---|---|
| Xanthophylls: | Lutein | Zeaxanthin | Fucoxanthin | |
| Carotenes: | Lycopene | Carotene | |